![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Business Model.pdf | 2024-05-07 21:09 | 179K | |
| CEO Statement.pdf | 2024-05-07 21:09 | 330K | |
| Chairperson Statement.pdf | 2024-05-07 21:09 | 293K | |
| DirectFN.pdf | 2024-05-07 21:09 | 586K | |
| English Full PDF.pdf | 2024-05-07 21:09 | 9.7M | |
| Financial Statements.pdf | 2024-05-07 21:09 | 1.1M | |
| IR and Shareholders Info.pdf | 2024-05-07 21:09 | 206K | |
| Notes to the Consilidated Financial Statements.pdf | 2024-05-07 21:09 | 503K | |
| Overview.pdf | 2024-05-07 21:09 | 1.5M | |
| Risk Management.pdf | 2024-05-07 21:09 | 350K | |
| Statement of Cash Flows.pdf | 2024-05-07 21:09 | 207K | |
| Statement of Changes in Equity.pdf | 2024-05-07 21:09 | 186K | |
| Statement of Financial Position.pdf | 2024-05-07 21:09 | 186K | |
| Statement of Profit or Loss.pdf | 2024-05-07 21:09 | 205K | |
| Strategic Aspiration.pdf | 2024-05-07 21:09 | 426K | |
| Strategic Review.pdf | 2024-05-07 21:09 | 2.1M | |
| Sustainability Approach.pdf | 2024-05-07 21:09 | 241K | |
| Vision 2030.pdf | 2024-05-07 21:09 | 291K | |
| Focus on employees_read_more.pdf | 2024-05-08 09:29 | 442K | |
| Subsidiaries_Read more.pdf | 2024-05-08 09:29 | 2.7M | |
| About the Group.pdf | 2024-05-26 21:08 | 274K | |
| Acquisition of DirectFN.pdf | 2024-05-26 21:08 | 588K | |
| At a Glance.pdf | 2024-05-26 21:08 | 208K | |
| Consolidated Statement of Cash Flows.pdf | 2024-05-26 21:08 | 207K | |
| Consolidated Statement of Changes in Equity.pdf | 2024-05-26 21:08 | 186K | |
| Consolidated Statement of Financial Position.pdf | 2024-05-26 21:08 | 186K | |
| Consolidated Statement of Profit or Loss and Other Comprehensive Income.pdf | 2024-05-26 21:08 | 205K | |
| Corporate Governance.pdf | 2024-05-26 21:08 | 1.8M | |
| Edaa.pdf | 2024-05-26 21:08 | 587K | |
| Enterprise Risk Management.pdf | 2024-05-26 21:08 | 334K | |
| Financial Review.pdf | 2024-05-26 21:08 | 452K | |
| Focus on Employees.pdf | 2024-05-26 21:08 | 442K | |
| Investment Case.pdf | 2024-05-26 21:08 | 330K | |
| Investor Relations and Shareholders Information.pdf | 2024-05-26 21:08 | 193K | |
| Material Topics.pdf | 2024-05-26 21:08 | 176K | |
| Muqassa.pdf | 2024-05-26 21:08 | 484K | |
| SCMF.pdf | 2024-05-26 21:08 | 274K | |
| Saudi Exchange.pdf | 2024-05-26 21:08 | 885K | |
| Stakeholder Engagement.pdf | 2024-05-26 21:08 | 407K | |
| Statement from the Chairperson.pdf | 2024-05-26 21:08 | 298K | |
| Statement from the Group Chief Executive Officer.pdf | 2024-05-26 21:08 | 339K | |
| Strategy (Strategic Aspiration with Ambitious Vision).pdf | 2024-05-26 21:08 | 320K | |
| Sustainability Approach in Saudi Tadawul Group.pdf | 2024-05-26 21:08 | 241K | |
| Sustainability Framework.pdf | 2024-05-26 21:08 | 130K | |
| Sustainability Pillars.pdf | 2024-05-26 21:08 | 273K | |
| The Group Journey.pdf | 2024-05-26 21:08 | 98K | |
| The Saudi Ambitious Vision 2030.pdf | 2024-05-26 21:08 | 278K | |
| WAMID.pdf | 2024-05-26 21:08 | 533K | |
| Year in Review.pdf | 2024-05-26 21:08 | 270K | |
| Consolidated Financial Statements.pdf | 2024-05-27 07:07 | 872K | |
| Subsidiaries.pdf | 2024-05-27 09:38 | 2.7M | |
| Sustainability.pdf | 2024-05-27 09:38 | 1.2M | |
| Board of Directors.pdf | 2024-06-03 11:54 | 747K | |
| Board of Directors Declarations.pdf | 2024-06-03 11:54 | 90K | |
| Business Model_spread_view.pdf | 2024-06-03 11:54 | 163K | |
| Disclosure Policy.pdf | 2024-06-03 11:54 | 99K | |
| Distribution of Dividends Policy.pdf | 2024-06-03 11:54 | 99K | |
| Executive Management.pdf | 2024-06-03 11:54 | 791K | |
| FS Spread View.pdf | 2024-06-03 11:54 | 872K | |
| General Assembly Meetings.pdf | 2024-06-03 11:54 | 112K | |
| Governance at Saudi Tadawul Group.pdf | 2024-06-03 11:54 | 114K | |
| Group Organizational Structure.pdf | 2024-06-03 11:54 | 106K | |
| Implemented and non-implemented provisions of the Corporate Governance Regulations.pdf | 2024-06-03 11:54 | 114K | |
| Leadership_combined.pdf | 2024-06-03 11:54 | 757K | |
| Procedure to inform Board members about Shareholders feedback on the Company and its performance.pdf | 2024-06-03 11:54 | 112K | |
| Shareholder records requests.pdf | 2024-06-03 11:54 | 121K | |
| Shareholders rights.pdf | 2024-06-03 11:54 | 90K | |
| Statement from the Chairperson_spread_view.pdf | 2024-06-03 11:54 | 298K | |
| Statement from the Group Chief Executive Officer_spread_view.pdf | 2024-06-03 11:54 | 339K | |
| Strategy (Strategic Aspiration with Ambitious Vision)_spread_view.pdf | 2024-06-03 11:54 | 320K | |
| Theme of the year_spread_view.pdf | 2024-06-03 11:54 | 345K | |
| Vision 2030_spread_view.pdf | 2024-06-03 11:54 | 278K | |
| Governance.pdf | 2024-06-14 21:31 | 114K | |
| Independent Auditors Report.pdf | 2024-06-14 21:31 | 233K | |
| Material Topic.pdf | 2024-06-14 21:31 | 176K | |
| Theme of the year.pdf | 2024-06-14 21:31 | 345K | |
![[DIR]](/icons/folder.gif) | ar/ | 2024-07-03 18:28 | - | |
|
|---|